C24H35N5O4S2 — CID 177279417
1-S-[3-oxo-3-(pentylamino)propyl] 4-S-phenyl 2-(6-azidohexanoylamino)butanebis(thioate) (PubChem CID 177279417) has the molecular formula C24H35N5O4S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 1-S-[3-oxo-3-(pentylamino)propyl] 4-S-phenyl 2-(6-azidohexanoylamino)butanebis(thioate).
| Compound Name | 1-S-[3-oxo-3-(pentylamino)propyl] 4-S-phenyl 2-(6-azidohexanoylamino)butanebis(thioate) |
|---|---|
| PubChem CID | 177279417 |
| Molecular Formula | C24H35N5O4S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 1-S-[3-oxo-3-(pentylamino)propyl] 4-S-phenyl 2-(6-azidohexanoylamino)butanebis(thioate) |
| SMILES | CCCCCNC(=O)CCSC(=O)C(CC(=O)Sc1ccccc1)NC(=O)CCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C24H35N5O4S2/c1-2-3-9-15-26-21(30)14-17-34-24(33)20(18-23(32)35-19-11-6-4-7-12-19)28-22(31)13-8-5-10-16-27-29-25/h4,6-7,11-12,20H,2-3,5,8-10,13-18H2,1H3,(H,26,30)(H,28,31) |
| InChIKey | YUIXXCDFAQXXFQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|