C55H36N4 — CID 177283369
3-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-[3-[8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177283369) has the molecular formula C55H36N4 and a molecular weight of 762.98 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-[3-[8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 3-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-[3-[8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177283369 |
| Molecular Formula | C55H36N4 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.36 |
| IUPAC Name | 3-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[4-[3-[8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cccc6cccc(-c7c([2H])c([2H])c([2H])c([2H])c7[2H])c56)c4)n3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C55H36N4/c1-4-15-37(16-5-1)42-31-34-51-49(36-42)48-25-10-11-28-50(48)59(51)45-32-29-41(30-33-45)54-56-53(40-19-8-3-9-20-40)57-55(58-54)44-24-12-23-43(35-44)47-27-14-22-39-21-13-26-46(52(39)47)38-17-6-2-7-18-38/h1-36H/i1D,2D,4D,5D,6D,7D,15D,16D,17D,18D |
| InChIKey | AZRYKLBKDPNYRI-ZSQOHLCXSA-N |
| XLogP | 14.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |