C13H18O3 — CID 177285110
methyl (2R,3aS)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate (PubChem CID 177285110) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is methyl (2R,3aS)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate.
| Compound Name | methyl (2R,3aS)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate |
|---|---|
| PubChem CID | 177285110 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | methyl (2R,3aS)-2-prop-2-ynoxy-2,3,4,5,6,6a-hexahydro-1H-pentalene-3a-carboxylate |
| SMILES | C#CCO[C@@H]1CC2CCC[C@]2(C(=O)OC)C1 |
| InChI | InChI=1S/C13H18O3/c1-3-7-16-11-8-10-5-4-6-13(10,9-11)12(14)15-2/h1,10-11H,4-9H2,2H3/t10?,11-,13+/m1/s1 |
| InChIKey | OPBBMHJIYCUHPS-ZNVNOEFISA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|