C15H12F5NO4S — CID 177288010
2-(4-formylphenoxy)-N-[2-(pentafluoro-λ6-sulfanyl)oxyphenyl]acetamide (PubChem CID 177288010) has the molecular formula C15H12F5NO4S and a molecular weight of 397.32 g/mol. Its IUPAC name is 2-(4-formylphenoxy)-N-[2-(pentafluoro-λ6-sulfanyl)oxyphenyl]acetamide.
| Compound Name | 2-(4-formylphenoxy)-N-[2-(pentafluoro-λ6-sulfanyl)oxyphenyl]acetamide |
|---|---|
| PubChem CID | 177288010 |
| Molecular Formula | C15H12F5NO4S |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-(4-formylphenoxy)-N-[2-(pentafluoro-λ6-sulfanyl)oxyphenyl]acetamide |
| SMILES | O=Cc1ccc(OCC(=O)Nc2ccccc2OS(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F5NO4S/c16-26(17,18,19,20)25-14-4-2-1-3-13(14)21-15(23)10-24-12-7-5-11(9-22)6-8-12/h1-9H,10H2,(H,21,23) |
| InChIKey | DPMRBEBGVRDFEY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|