About 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide
5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide (PubChem CID 177290599) has the molecular formula C8H7N5O2
and a molecular weight of 205.18 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide.
Molecular Properties
| Compound Name | 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide |
| PubChem CID | 177290599 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide |
| SMILES | NC(=O)c1cnc2[nH]cc(C(N)=O)c2n1 |
| InChI | InChI=1S/C8H7N5O2/c9-6(14)3-1-11-8-5(3)13-4(2-12-8)7(10)15/h1-2H,(H2,9,14)(H2,10,15)(H,11,12) |
| InChIKey | FYUNVRJXQWRZDA-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide?
The IUPAC name of 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide (CID 177290599) is 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide.
What is the SMILES notation for 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide?
The canonical SMILES for 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide is NC(=O)c1cnc2[nH]cc(C(N)=O)c2n1.
What is the InChIKey of 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide?
The InChIKey is FYUNVRJXQWRZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2/c9-6(14)3-1-11-8-5(3)13-4(2-12-8)7(10)15/h1-2H,(H2,9,14)(H2,10,15)(H,11,12).
What are the key properties of 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide?
5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide has a molecular weight of 205.18 g/mol, XLogP of -0.84, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[2,3-b]pyrazine-2,7-dicarboxamide is sourced from PubChem (CID 177290599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).