C25H34N6O2 — CID 177290932
N-[(E)-4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)but-2-enyl]-2-hydroxy-N-piperidin-4-ylacetamide (PubChem CID 177290932) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[(E)-4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)but-2-enyl]-2-hydroxy-N-piperidin-4-ylacetamide.
| Compound Name | N-[(E)-4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)but-2-enyl]-2-hydroxy-N-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 177290932 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | N-[(E)-4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)but-2-enyl]-2-hydroxy-N-piperidin-4-ylacetamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1C/C=C/CN(C(=O)CO)C1CCNCC1 |
| InChI | InChI=1S/C25H34N6O2/c1-2-3-10-21-29-23-24(19-8-4-5-9-20(19)28-25(23)26)31(21)16-7-6-15-30(22(33)17-32)18-11-13-27-14-12-18/h4-9,18,27,32H,2-3,10-17H2,1H3,(H2,26,28)/b7-6+ |
| InChIKey | OKBPAZLJKCRSGC-VOTSOKGWSA-N |
| XLogP | 2.64 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|