C29H39N5 — CID 177290907
1-[(E)-4-(1-adamantylmethylamino)but-2-enyl]-2-butylimidazo[4,5-c]quinolin-4-amine (PubChem CID 177290907) has the molecular formula C29H39N5 and a molecular weight of 457.67 g/mol. Its IUPAC name is 1-[(E)-4-(1-adamantylmethylamino)but-2-enyl]-2-butylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[(E)-4-(1-adamantylmethylamino)but-2-enyl]-2-butylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 177290907 |
| Molecular Formula | C29H39N5 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | 1-[(E)-4-(1-adamantylmethylamino)but-2-enyl]-2-butylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1C/C=C/CNCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H39N5/c1-2-3-10-25-33-26-27(23-8-4-5-9-24(23)32-28(26)30)34(25)12-7-6-11-31-19-29-16-20-13-21(17-29)15-22(14-20)18-29/h4-9,20-22,31H,2-3,10-19H2,1H3,(H2,30,32)/b7-6+ |
| InChIKey | RTEGGSXMUUICSY-VOTSOKGWSA-N |
| XLogP | 5.87 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|