C18H14N4O2 — CID 177295527
2-amino-6-(4-aminophenyl)-4-(3,4-dihydroxyphenyl)pyridine-3-carbonitrile (PubChem CID 177295527) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-amino-6-(4-aminophenyl)-4-(3,4-dihydroxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-aminophenyl)-4-(3,4-dihydroxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 177295527 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-amino-6-(4-aminophenyl)-4-(3,4-dihydroxyphenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(O)c(O)c2)cc(-c2ccc(N)cc2)nc1N |
| InChI | InChI=1S/C18H14N4O2/c19-9-14-13(11-3-6-16(23)17(24)7-11)8-15(22-18(14)21)10-1-4-12(20)5-2-10/h1-8,23-24H,20H2,(H2,21,22) |
| InChIKey | LJCTWPCRPDZTBA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|