C20H19NO5 — CID 177296719
methyl (Z)-4-hydroxy-2-[5-[(4-isocyanophenoxy)methyl]-2-methylphenoxy]but-2-enoate (PubChem CID 177296719) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl (Z)-4-hydroxy-2-[5-[(4-isocyanophenoxy)methyl]-2-methylphenoxy]but-2-enoate.
| Compound Name | methyl (Z)-4-hydroxy-2-[5-[(4-isocyanophenoxy)methyl]-2-methylphenoxy]but-2-enoate |
|---|---|
| PubChem CID | 177296719 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | methyl (Z)-4-hydroxy-2-[5-[(4-isocyanophenoxy)methyl]-2-methylphenoxy]but-2-enoate |
| SMILES | [C-]#[N+]c1ccc(OCc2ccc(C)c(O/C(=C\CO)C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C20H19NO5/c1-14-4-5-15(13-25-17-8-6-16(21-2)7-9-17)12-19(14)26-18(10-11-22)20(23)24-3/h4-10,12,22H,11,13H2,1,3H3/b18-10- |
| InChIKey | AUJZMGZJTXSAFX-ZDLGFXPLSA-N |
| XLogP | 3.55 |
| TPSA | 69.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|