C54H30N6 — CID 177297047
7'-isocyano-2-[2-[3-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]quinazolin-4-yl]-9,9'-spirobi[fluorene]-2'-carbonitrile (PubChem CID 177297047) has the molecular formula C54H30N6 and a molecular weight of 762.88 g/mol. Its IUPAC name is 7'-isocyano-2-[2-[3-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]quinazolin-4-yl]-9,9'-spirobi[fluorene]-2'-carbonitrile.
| Compound Name | 7'-isocyano-2-[2-[3-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]quinazolin-4-yl]-9,9'-spirobi[fluorene]-2'-carbonitrile |
|---|---|
| PubChem CID | 177297047 |
| Molecular Formula | C54H30N6 |
| Molecular Weight | 762.88 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | 7'-isocyano-2-[2-[3-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]quinazolin-4-yl]-9,9'-spirobi[fluorene]-2'-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4nc(-c5cccc(-c6c(-c7ccccc7)nc7ccccn67)c5)nc5ccccc45)cc31)c1cc(C#N)ccc1-2 |
| InChI | InChI=1S/C54H30N6/c1-56-38-23-26-42-40-24-21-33(32-55)28-45(40)54(47(42)31-38)44-18-7-5-16-39(44)41-25-22-35(30-46(41)54)50-43-17-6-8-19-48(43)57-53(59-50)37-15-11-14-36(29-37)52-51(34-12-3-2-4-13-34)58-49-20-9-10-27-60(49)52/h2-31H |
| InChIKey | CETPSISKHIYOGI-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 71.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.88 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|