About 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide
6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide (PubChem CID 177300833) has the molecular formula C12H18N4O
and a molecular weight of 240.34 g/mol. Its IUPAC name is 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide |
| PubChem CID | 177300833 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)c1ccc(N2CCNCC2)nc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H18N4O/c1-15(2)12(17)10-3-4-11(14-9-10)16-7-5-13-6-8-16/h3-4,9,13H,5-8H2,1-2H3/i1D3,2D3 |
| InChIKey | YCEPJLOTPCEEAD-WFGJKAKNSA-N |
| XLogP | 0.19 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide?
The IUPAC name of 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide (CID 177300833) is 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide.
What is the SMILES notation for 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide?
The canonical SMILES for 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide is [2H]C([2H])([2H])N(C(=O)c1ccc(N2CCNCC2)nc1)C([2H])([2H])[2H].
What is the InChIKey of 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide?
The InChIKey is YCEPJLOTPCEEAD-WFGJKAKNSA-N. The full InChI is InChI=1S/C12H18N4O/c1-15(2)12(17)10-3-4-11(14-9-10)16-7-5-13-6-8-16/h3-4,9,13H,5-8H2,1-2H3/i1D3,2D3.
What are the key properties of 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide?
6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide has a molecular weight of 240.34 g/mol, XLogP of 0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-yl-N,N-bis(trideuteriomethyl)pyridine-3-carboxamide is sourced from PubChem (CID 177300833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).