C20H17F2N3O — CID 177306792
6-(2,4-difluorophenyl)-5-[1,1,2,2-tetradeuterio-2-(2-methylpyrazol-3-yl)ethyl]-2,3-dihydroisoindol-1-one (PubChem CID 177306792) has the molecular formula C20H17F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-5-[1,1,2,2-tetradeuterio-2-(2-methylpyrazol-3-yl)ethyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-(2,4-difluorophenyl)-5-[1,1,2,2-tetradeuterio-2-(2-methylpyrazol-3-yl)ethyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 177306792 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-(2,4-difluorophenyl)-5-[1,1,2,2-tetradeuterio-2-(2-methylpyrazol-3-yl)ethyl]-2,3-dihydroisoindol-1-one |
| SMILES | [2H]C([2H])(c1cc2c(cc1-c1ccc(F)cc1F)C(=O)NC2)C([2H])([2H])c1ccnn1C |
| InChI | InChI=1S/C20H17F2N3O/c1-25-15(6-7-24-25)4-2-12-8-13-11-23-20(26)18(13)10-17(12)16-5-3-14(21)9-19(16)22/h3,5-10H,2,4,11H2,1H3,(H,23,26)/i2D2,4D2 |
| InChIKey | QYEXEIUOPHYSNQ-BYUTVXSXSA-N |
| XLogP | 3.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |