C21H16F2N2O2 — CID 171735581
6-(2,4-difluorophenyl)-5-(1-pyridin-4-ylethoxy)-2,3-dihydroisoindol-1-one (PubChem CID 171735581) has the molecular formula C21H16F2N2O2 and a molecular weight of 366.37 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-5-(1-pyridin-4-ylethoxy)-2,3-dihydroisoindol-1-one.
| Compound Name | 6-(2,4-difluorophenyl)-5-(1-pyridin-4-ylethoxy)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 171735581 |
| Molecular Formula | C21H16F2N2O2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-(2,4-difluorophenyl)-5-(1-pyridin-4-ylethoxy)-2,3-dihydroisoindol-1-one |
| SMILES | CC(Oc1cc2c(cc1-c1ccc(F)cc1F)C(=O)NC2)c1ccncc1 |
| InChI | InChI=1S/C21H16F2N2O2/c1-12(13-4-6-24-7-5-13)27-20-8-14-11-25-21(26)17(14)10-18(20)16-3-2-15(22)9-19(16)23/h2-10,12H,11H2,1H3,(H,25,26) |
| InChIKey | QNJMROGFLZUBKO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |