C16H14FN5O — CID 177308012
(2-amino-4-pyridinyl)-[3-(4-fluoro-2H-indazol-3-yl)azetidin-1-yl]methanone (PubChem CID 177308012) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is (2-amino-4-pyridinyl)-[3-(4-fluoro-2H-indazol-3-yl)azetidin-1-yl]methanone.
| Compound Name | (2-amino-4-pyridinyl)-[3-(4-fluoro-2H-indazol-3-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 177308012 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2-amino-4-pyridinyl)-[3-(4-fluoro-2H-indazol-3-yl)azetidin-1-yl]methanone |
| SMILES | Nc1cc(C(=O)N2CC(c3[nH]nc4cccc(F)c34)C2)ccn1 |
| InChI | InChI=1S/C16H14FN5O/c17-11-2-1-3-12-14(11)15(21-20-12)10-7-22(8-10)16(23)9-4-5-19-13(18)6-9/h1-6,10H,7-8H2,(H2,18,19)(H,20,21) |
| InChIKey | QVBYEZWCKJQYEH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |