C17H17N3OS — CID 177309767
5-(3,5-dimethylphenyl)-4-methylsulfinyl-1-phenyltriazole (PubChem CID 177309767) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-4-methylsulfinyl-1-phenyltriazole.
| Compound Name | 5-(3,5-dimethylphenyl)-4-methylsulfinyl-1-phenyltriazole |
|---|---|
| PubChem CID | 177309767 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-4-methylsulfinyl-1-phenyltriazole |
| SMILES | Cc1cc(C)cc(-c2c(S(C)=O)nnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C17H17N3OS/c1-12-9-13(2)11-14(10-12)16-17(22(3)21)18-19-20(16)15-7-5-4-6-8-15/h4-11H,1-3H3 |
| InChIKey | NITZVHFVLHVOGY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |