C22H22ClF2N5O2 — CID 177311994
6-chloro-3-[4-(2,4-difluorophenoxy)piperidin-1-yl]-N-[(3R)-oxolan-3-yl]pyrido[2,3-b]pyrazin-2-amine (PubChem CID 177311994) has the molecular formula C22H22ClF2N5O2 and a molecular weight of 461.90 g/mol. Its IUPAC name is 6-chloro-3-[4-(2,4-difluorophenoxy)piperidin-1-yl]-N-[(3R)-oxolan-3-yl]pyrido[2,3-b]pyrazin-2-amine.
| Compound Name | 6-chloro-3-[4-(2,4-difluorophenoxy)piperidin-1-yl]-N-[(3R)-oxolan-3-yl]pyrido[2,3-b]pyrazin-2-amine |
|---|---|
| PubChem CID | 177311994 |
| Molecular Formula | C22H22ClF2N5O2 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 6-chloro-3-[4-(2,4-difluorophenoxy)piperidin-1-yl]-N-[(3R)-oxolan-3-yl]pyrido[2,3-b]pyrazin-2-amine |
| SMILES | Fc1ccc(OC2CCN(c3nc4nc(Cl)ccc4nc3N[C@@H]3CCOC3)CC2)c(F)c1 |
| InChI | InChI=1S/C22H22ClF2N5O2/c23-19-4-2-17-20(28-19)29-22(21(27-17)26-14-7-10-31-12-14)30-8-5-15(6-9-30)32-18-3-1-13(24)11-16(18)25/h1-4,11,14-15H,5-10,12H2,(H,26,27)/t14-/m1/s1 |
| InChIKey | DDXNKXIRGKCTNM-CQSZACIVSA-N |
| XLogP | 4.20 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|