About 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine
2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine (PubChem CID 90038113) has the molecular formula C18H15F3N4O
and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine |
| PubChem CID | 90038113 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine |
| SMILES | Fc1ccc(OC2CCN(c3nc4ccncc4nc3F)CC2)c(F)c1 |
| InChI | InChI=1S/C18H15F3N4O/c19-11-1-2-16(13(20)9-11)26-12-4-7-25(8-5-12)18-17(21)23-15-10-22-6-3-14(15)24-18/h1-3,6,9-10,12H,4-5,7-8H2 |
| InChIKey | UNOPFEVKEJESDY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine?
The IUPAC name of 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine (CID 90038113) is 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine.
What is the SMILES notation for 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine?
The canonical SMILES for 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine is Fc1ccc(OC2CCN(c3nc4ccncc4nc3F)CC2)c(F)c1.
What is the InChIKey of 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine?
The InChIKey is UNOPFEVKEJESDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N4O/c19-11-1-2-16(13(20)9-11)26-12-4-7-25(8-5-12)18-17(21)23-15-10-22-6-3-14(15)24-18/h1-3,6,9-10,12H,4-5,7-8H2.
What are the key properties of 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine?
2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine has a molecular weight of 360.34 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-3-fluoropyrido[3,4-b]pyrazine is sourced from PubChem (CID 90038113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).