About 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid
1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid (PubChem CID 178142750) has the molecular formula C19H18ClF2N3O3
and a molecular weight of 409.82 g/mol. Its IUPAC name is 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid |
| PubChem CID | 178142750 |
| Molecular Formula | C19H18ClF2N3O3 |
| Molecular Weight | 409.82 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cnc(N3CCC(Oc4ccc(F)cc4F)CC3)c(Cl)n2)CC1 |
| InChI | InChI=1S/C19H18ClF2N3O3/c20-16-17(23-10-15(24-16)19(5-6-19)18(26)27)25-7-3-12(4-8-25)28-14-2-1-11(21)9-13(14)22/h1-2,9-10,12H,3-8H2,(H,26,27) |
| InChIKey | NBZCIVFEDGQROW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.82 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid (CID 178142750) is 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid is O=C(O)C1(c2cnc(N3CCC(Oc4ccc(F)cc4F)CC3)c(Cl)n2)CC1.
What is the InChIKey of 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid?
The InChIKey is NBZCIVFEDGQROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClF2N3O3/c20-16-17(23-10-15(24-16)19(5-6-19)18(26)27)25-7-3-12(4-8-25)28-14-2-1-11(21)9-13(14)22/h1-2,9-10,12H,3-8H2,(H,26,27).
What are the key properties of 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid?
1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid has a molecular weight of 409.82 g/mol, XLogP of 3.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-chloro-5-[4-(2,4-difluorophenoxy)piperidin-1-yl]pyrazin-2-yl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 178142750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).