C11H13Br2NO3 — CID 177314291
2,6-dibromo-4-hydroxy-4-(morpholin-4-ylmethyl)cyclohexa-2,5-dien-1-one (PubChem CID 177314291) has the molecular formula C11H13Br2NO3 and a molecular weight of 367.04 g/mol. Its IUPAC name is 2,6-dibromo-4-hydroxy-4-(morpholin-4-ylmethyl)cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-dibromo-4-hydroxy-4-(morpholin-4-ylmethyl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 177314291 |
| Molecular Formula | C11H13Br2NO3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 2,6-dibromo-4-hydroxy-4-(morpholin-4-ylmethyl)cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C(Br)=CC(O)(CN2CCOCC2)C=C1Br |
| InChI | InChI=1S/C11H13Br2NO3/c12-8-5-11(16,6-9(13)10(8)15)7-14-1-3-17-4-2-14/h5-6,16H,1-4,7H2 |
| InChIKey | MRPHRSPZOYIHQY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|