C26H21N3O4 — CID 177314921
(3E)-3-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylidene]-1-(4-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 177314921) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is (3E)-3-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylidene]-1-(4-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylidene]-1-(4-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177314921 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (3E)-3-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methylidene]-1-(4-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2ccccc2N2CCc3ccccc3C2)C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H21N3O4/c30-25-16-21(26(31)28(25)22-9-11-23(12-10-22)29(32)33)15-19-6-3-4-8-24(19)27-14-13-18-5-1-2-7-20(18)17-27/h1-12,15H,13-14,16-17H2/b21-15+ |
| InChIKey | YMVZQYCVJWPBQC-RCCKNPSSSA-N |
| XLogP | 4.50 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|