C24H26ClN5O3Si — CID 177316186
N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-chloro-5-[2-(2-nitro-3-pyridinyl)ethynyl]pyrimidin-4-amine (PubChem CID 177316186) has the molecular formula C24H26ClN5O3Si and a molecular weight of 496.04 g/mol. Its IUPAC name is N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-chloro-5-[2-(2-nitro-3-pyridinyl)ethynyl]pyrimidin-4-amine.
| Compound Name | N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-chloro-5-[2-(2-nitro-3-pyridinyl)ethynyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 177316186 |
| Molecular Formula | C24H26ClN5O3Si |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-chloro-5-[2-(2-nitro-3-pyridinyl)ethynyl]pyrimidin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(Nc2nc(Cl)ncc2C#Cc2cccnc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H26ClN5O3Si/c1-24(2,3)34(4,5)33-16-17-8-12-20(13-9-17)28-21-19(15-27-23(25)29-21)11-10-18-7-6-14-26-22(18)30(31)32/h6-9,12-15H,16H2,1-5H3,(H,27,28,29) |
| InChIKey | WVMLAJYASIHCTP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|