C22H28ClN5OSi — CID 155649618
N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-chloro-5-pyrimidin-2-ylpyrimidin-4-amine (PubChem CID 155649618) has the molecular formula C22H28ClN5OSi and a molecular weight of 442.04 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-chloro-5-pyrimidin-2-ylpyrimidin-4-amine.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-chloro-5-pyrimidin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 155649618 |
| Molecular Formula | C22H28ClN5OSi |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-chloro-5-pyrimidin-2-ylpyrimidin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCC(Nc1nc(Cl)ncc1-c1ncccn1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClN5OSi/c1-22(2,3)30(4,5)29-15-18(16-10-7-6-8-11-16)27-20-17(14-26-21(23)28-20)19-24-12-9-13-25-19/h6-14,18H,15H2,1-5H3,(H,26,27,28) |
| InChIKey | FGLJAYDPJJKJLL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|