C27H34N2O2Si — CID 171774386
N-benzhydryl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuro[2,3-c]pyridin-7-amine (PubChem CID 171774386) has the molecular formula C27H34N2O2Si and a molecular weight of 446.67 g/mol. Its IUPAC name is N-benzhydryl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuro[2,3-c]pyridin-7-amine.
| Compound Name | N-benzhydryl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuro[2,3-c]pyridin-7-amine |
|---|---|
| PubChem CID | 171774386 |
| Molecular Formula | C27H34N2O2Si |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-benzhydryl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuro[2,3-c]pyridin-7-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCC1COc2c1ccnc2NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34N2O2Si/c1-27(2,3)32(4,5)31-19-22-18-30-25-23(22)16-17-28-26(25)29-24(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-17,22,24H,18-19H2,1-5H3,(H,28,29) |
| InChIKey | KEACQIFMPADNMH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|