C24H31N5 — CID 177316228
(Z)-but-2-ene;4-[[1-[(4-prop-1-en-2-ylphenyl)methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile (PubChem CID 177316228) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is (Z)-but-2-ene;4-[[1-[(4-prop-1-en-2-ylphenyl)methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile.
| Compound Name | (Z)-but-2-ene;4-[[1-[(4-prop-1-en-2-ylphenyl)methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 177316228 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | (Z)-but-2-ene;4-[[1-[(4-prop-1-en-2-ylphenyl)methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile |
| SMILES | C/C=C\C.C=C(C)c1ccc(CN2CCC(Nc3ccnc(C#N)n3)CC2)cc1 |
| InChI | InChI=1S/C20H23N5.C4H8/c1-15(2)17-5-3-16(4-6-17)14-25-11-8-18(9-12-25)23-19-7-10-22-20(13-21)24-19;1-3-4-2/h3-7,10,18H,1,8-9,11-12,14H2,2H3,(H,22,23,24);3-4H,1-2H3/b;4-3- |
| InChIKey | LTKWNDNMHSSWFF-QGAMPUOQSA-N |
| XLogP | 5.04 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|