C25H36BN5O2 — CID 177316274
ethane;4-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile (PubChem CID 177316274) has the molecular formula C25H36BN5O2 and a molecular weight of 449.41 g/mol. Its IUPAC name is ethane;4-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile.
| Compound Name | ethane;4-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 177316274 |
| Molecular Formula | C25H36BN5O2 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | ethane;4-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]amino]pyrimidine-2-carbonitrile |
| SMILES | CC.CC1(C)OB(c2ccc(CN3CCC(Nc4ccnc(C#N)n4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H30BN5O2.C2H6/c1-22(2)23(3,4)31-24(30-22)18-7-5-17(6-8-18)16-29-13-10-19(11-14-29)27-20-9-12-26-21(15-25)28-20;1-2/h5-9,12,19H,10-11,13-14,16H2,1-4H3,(H,26,27,28);1-2H3 |
| InChIKey | IHBSQQGOZBEHBJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|