C23H17FN6O3 — CID 177316297
[4-[2-[(Z)-3-(5-fluoro-2-pyridinyl)-3-iminoprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol (PubChem CID 177316297) has the molecular formula C23H17FN6O3 and a molecular weight of 444.43 g/mol. Its IUPAC name is [4-[2-[(Z)-3-(5-fluoro-2-pyridinyl)-3-iminoprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol.
| Compound Name | [4-[2-[(Z)-3-(5-fluoro-2-pyridinyl)-3-iminoprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 177316297 |
| Molecular Formula | C23H17FN6O3 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | [4-[2-[(Z)-3-(5-fluoro-2-pyridinyl)-3-iminoprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol |
| SMILES | [H]/N=C(/C=C\c1nc(-c2ccc(CO)cc2)c(-c2cccnc2[N+](=O)[O-])[nH]1)c1ccc(F)cn1 |
| InChI | InChI=1S/C23H17FN6O3/c24-16-7-9-19(27-12-16)18(25)8-10-20-28-21(15-5-3-14(13-31)4-6-15)22(29-20)17-2-1-11-26-23(17)30(32)33/h1-12,25,31H,13H2,(H,28,29)/b10-8-,25-18- |
| InChIKey | VQVXADJUPFULKE-YJBFWYHZSA-N |
| XLogP | 4.15 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|