C24H19N5O3 — CID 177316522
[4-[2-[(Z)-3-imino-3-phenylprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol (PubChem CID 177316522) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is [4-[2-[(Z)-3-imino-3-phenylprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol.
| Compound Name | [4-[2-[(Z)-3-imino-3-phenylprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 177316522 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [4-[2-[(Z)-3-imino-3-phenylprop-1-enyl]-5-(2-nitro-3-pyridinyl)-1H-imidazol-4-yl]phenyl]methanol |
| SMILES | [H]/N=C(/C=C\c1nc(-c2ccc(CO)cc2)c(-c2cccnc2[N+](=O)[O-])[nH]1)c1ccccc1 |
| InChI | InChI=1S/C24H19N5O3/c25-20(17-5-2-1-3-6-17)12-13-21-27-22(18-10-8-16(15-30)9-11-18)23(28-21)19-7-4-14-26-24(19)29(31)32/h1-14,25,30H,15H2,(H,27,28)/b13-12-,25-20- |
| InChIKey | AXPFKVZDYBTAIT-FMMDKACJSA-N |
| XLogP | 4.62 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|