C28H21N3O7 — CID 59926015
(E)-3-[4-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-methoxy-2-nitrophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid (PubChem CID 59926015) has the molecular formula C28H21N3O7 and a molecular weight of 511.49 g/mol. Its IUPAC name is (E)-3-[4-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-methoxy-2-nitrophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-methoxy-2-nitrophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59926015 |
| Molecular Formula | C28H21N3O7 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | (E)-3-[4-[4-[4-[(E)-2-carboxyethenyl]phenyl]-2-(3-methoxy-2-nitrophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1cccc(-c2nc(-c3ccc(/C=C/C(=O)O)cc3)c(-c3ccc(/C=C/C(=O)O)cc3)[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C28H21N3O7/c1-38-22-4-2-3-21(27(22)31(36)37)28-29-25(19-11-5-17(6-12-19)9-15-23(32)33)26(30-28)20-13-7-18(8-14-20)10-16-24(34)35/h2-16H,1H3,(H,29,30)(H,32,33)(H,34,35)/b15-9+,16-10+ |
| InChIKey | PNCMFEBNPXAMTR-KAVGSWPWSA-N |
| XLogP | 5.52 |
| TPSA | 155.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|