C28H21FN2O5 — CID 85082450
3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluoro-4-methoxyphenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid (PubChem CID 85082450) has the molecular formula C28H21FN2O5 and a molecular weight of 484.48 g/mol. Its IUPAC name is 3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluoro-4-methoxyphenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluoro-4-methoxyphenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 85082450 |
| Molecular Formula | C28H21FN2O5 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluoro-4-methoxyphenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(-c2nc(-c3ccc(C=CC(=O)O)cc3)c(-c3ccc(C=CC(=O)O)cc3)[nH]2)cc1F |
| InChI | InChI=1S/C28H21FN2O5/c1-36-23-13-12-21(16-22(23)29)28-30-26(19-8-2-17(3-9-19)6-14-24(32)33)27(31-28)20-10-4-18(5-11-20)7-15-25(34)35/h2-16H,1H3,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | ANLWNFOVTRKKMJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|