C38H33F2N3O4 — CID 10349104
(E)-3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[(E)-3-[(2,5-difluorophenyl)methoxy]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]prop-2-enoic acid (PubChem CID 10349104) has the molecular formula C38H33F2N3O4 and a molecular weight of 633.69 g/mol. Its IUPAC name is (E)-3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[(E)-3-[(2,5-difluorophenyl)methoxy]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[(E)-3-[(2,5-difluorophenyl)methoxy]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10349104 |
| Molecular Formula | C38H33F2N3O4 |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | (E)-3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[(E)-3-[(2,5-difluorophenyl)methoxy]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]prop-2-enoic acid |
| SMILES | CCN(CC)c1ccc(-c2nc(-c3ccc(/C=C/C(=O)O)cc3)c(-c3ccc(/C=C/C(=O)OCc4cc(F)ccc4F)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C38H33F2N3O4/c1-3-43(4-2)32-18-15-29(16-19-32)38-41-36(27-11-5-25(6-12-27)9-21-34(44)45)37(42-38)28-13-7-26(8-14-28)10-22-35(46)47-24-30-23-31(39)17-20-33(30)40/h5-23H,3-4,24H2,1-2H3,(H,41,42)(H,44,45)/b21-9+,22-10+ |
| InChIKey | TWZUQIKMZFIWRZ-VGENTYGXSA-N |
| XLogP | 8.39 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|