C42H40N6O4 — CID 54569098
3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 54569098) has the molecular formula C42H40N6O4 and a molecular weight of 692.82 g/mol. Its IUPAC name is 3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 54569098 |
| Molecular Formula | C42H40N6O4 |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | 3-[4-[2-[4-(diethylamino)phenyl]-5-[4-[3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]phenyl]-1H-imidazol-4-yl]phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| SMILES | CCN(CC)c1ccc(-c2nc(-c3ccc(C4=NOC(C(=O)O)C4)cc3)c(-c3ccc(C=CC(=O)NCCc4c[nH]c5ccccc45)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C42H40N6O4/c1-3-48(4-2)33-20-18-31(19-21-33)41-45-39(40(46-41)30-16-14-28(15-17-30)36-25-37(42(50)51)52-47-36)29-12-9-27(10-13-29)11-22-38(49)43-24-23-32-26-44-35-8-6-5-7-34(32)35/h5-22,26,37,44H,3-4,23-25H2,1-2H3,(H,43,49)(H,45,46)(H,50,51) |
| InChIKey | ZVYXPTGUUGLXCA-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|