C27H19FN2O4 — CID 85051052
3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluorophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid (PubChem CID 85051052) has the molecular formula C27H19FN2O4 and a molecular weight of 454.46 g/mol. Its IUPAC name is 3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluorophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluorophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 85051052 |
| Molecular Formula | C27H19FN2O4 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3-[4-[4-[4-(2-carboxyethenyl)phenyl]-2-(3-fluorophenyl)-1H-imidazol-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2nc(-c3cccc(F)c3)[nH]c2-c2ccc(C=CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H19FN2O4/c28-22-3-1-2-21(16-22)27-29-25(19-10-4-17(5-11-19)8-14-23(31)32)26(30-27)20-12-6-18(7-13-20)9-15-24(33)34/h1-16H,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | UHEFUSYLTVLHHL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|