C17H11FN6O2 — CID 177316439
6-(5-fluoro-2-pyridinyl)-3-methyl-2-(2-nitro-3-pyridinyl)imidazo[1,2-b]pyridazine (PubChem CID 177316439) has the molecular formula C17H11FN6O2 and a molecular weight of 350.31 g/mol. Its IUPAC name is 6-(5-fluoro-2-pyridinyl)-3-methyl-2-(2-nitro-3-pyridinyl)imidazo[1,2-b]pyridazine.
| Compound Name | 6-(5-fluoro-2-pyridinyl)-3-methyl-2-(2-nitro-3-pyridinyl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 177316439 |
| Molecular Formula | C17H11FN6O2 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 6-(5-fluoro-2-pyridinyl)-3-methyl-2-(2-nitro-3-pyridinyl)imidazo[1,2-b]pyridazine |
| SMILES | Cc1c(-c2cccnc2[N+](=O)[O-])nc2ccc(-c3ccc(F)cn3)nn12 |
| InChI | InChI=1S/C17H11FN6O2/c1-10-16(12-3-2-8-19-17(12)24(25)26)21-15-7-6-14(22-23(10)15)13-5-4-11(18)9-20-13/h2-9H,1H3 |
| InChIKey | JFJQNOBQVVPVBO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|