C18H13N5O6 — CID 10524721
methyl 2-methyl-4,6-bis(2-nitro-3-pyridinyl)pyridine-3-carboxylate (PubChem CID 10524721) has the molecular formula C18H13N5O6 and a molecular weight of 395.33 g/mol. Its IUPAC name is methyl 2-methyl-4,6-bis(2-nitro-3-pyridinyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-methyl-4,6-bis(2-nitro-3-pyridinyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10524721 |
| Molecular Formula | C18H13N5O6 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | methyl 2-methyl-4,6-bis(2-nitro-3-pyridinyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccnc2[N+](=O)[O-])cc(-c2cccnc2[N+](=O)[O-])nc1C |
| InChI | InChI=1S/C18H13N5O6/c1-10-15(18(24)29-2)13(11-5-3-7-19-16(11)22(25)26)9-14(21-10)12-6-4-8-20-17(12)23(27)28/h3-9H,1-2H3 |
| InChIKey | UPKBIZAUUMJKJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 151.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|