C18H13Cl2N3O2 — CID 10571417
methyl 4,6-bis(2-chloro-3-pyridinyl)-2-methylpyridine-3-carboxylate (PubChem CID 10571417) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is methyl 4,6-bis(2-chloro-3-pyridinyl)-2-methylpyridine-3-carboxylate.
| Compound Name | methyl 4,6-bis(2-chloro-3-pyridinyl)-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 10571417 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | methyl 4,6-bis(2-chloro-3-pyridinyl)-2-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cccnc2Cl)cc(-c2cccnc2Cl)nc1C |
| InChI | InChI=1S/C18H13Cl2N3O2/c1-10-15(18(24)25-2)13(11-5-3-7-21-16(11)19)9-14(23-10)12-6-4-8-22-17(12)20/h3-9H,1-2H3 |
| InChIKey | WMOQRMNLRCRPFV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|