C9H8FN3 — CID 177316366
2-(5-fluoro-2-pyridinyl)-4,5-dihydropyrimidine (PubChem CID 177316366) has the molecular formula C9H8FN3 and a molecular weight of 177.18 g/mol. Its IUPAC name is 2-(5-fluoro-2-pyridinyl)-4,5-dihydropyrimidine.
| Compound Name | 2-(5-fluoro-2-pyridinyl)-4,5-dihydropyrimidine |
|---|---|
| PubChem CID | 177316366 |
| Molecular Formula | C9H8FN3 |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 2-(5-fluoro-2-pyridinyl)-4,5-dihydropyrimidine |
| SMILES | Fc1ccc(C2=NCCC=N2)nc1 |
| InChI | InChI=1S/C9H8FN3/c10-7-2-3-8(13-6-7)9-11-4-1-5-12-9/h2-4,6H,1,5H2 |
| InChIKey | PAJCKWGBNJMDNP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |