C14H22F3N3 — CID 177317770
(2R)-2-methylazepane;N-methyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 177317770) has the molecular formula C14H22F3N3 and a molecular weight of 289.34 g/mol. Its IUPAC name is (2R)-2-methylazepane;N-methyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | (2R)-2-methylazepane;N-methyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 177317770 |
| Molecular Formula | C14H22F3N3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2R)-2-methylazepane;N-methyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CNc1ccc(C(F)(F)F)cn1.C[C@@H]1CCCCCN1 |
| InChI | InChI=1S/C7H7F3N2.C7H15N/c1-11-6-3-2-5(4-12-6)7(8,9)10;1-7-5-3-2-4-6-8-7/h2-4H,1H3,(H,11,12);7-8H,2-6H2,1H3/t;7-/m.1/s1 |
| InChIKey | FXXNKKQKWCQQHX-HMZWWLAASA-N |
| XLogP | 3.68 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |