C22H25ClFN5O3S — CID 177319584
2-[7-(4-chloro-2-fluorophenyl)-4,5-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(2,2-dimethoxyethylamino)ethanol (PubChem CID 177319584) has the molecular formula C22H25ClFN5O3S and a molecular weight of 493.99 g/mol. Its IUPAC name is 2-[7-(4-chloro-2-fluorophenyl)-4,5-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(2,2-dimethoxyethylamino)ethanol.
| Compound Name | 2-[7-(4-chloro-2-fluorophenyl)-4,5-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(2,2-dimethoxyethylamino)ethanol |
|---|---|
| PubChem CID | 177319584 |
| Molecular Formula | C22H25ClFN5O3S |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[7-(4-chloro-2-fluorophenyl)-4,5-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-1-(2,2-dimethoxyethylamino)ethanol |
| SMILES | COC(CNC(O)CC1N=C(c2ccc(Cl)cc2F)c2c(sc(C)c2C)-n2cnnc21)OC |
| InChI | InChI=1S/C22H25ClFN5O3S/c1-11-12(2)33-22-19(11)20(14-6-5-13(23)7-15(14)24)27-16(21-28-26-10-29(21)22)8-17(30)25-9-18(31-3)32-4/h5-7,10,16-18,25,30H,8-9H2,1-4H3 |
| InChIKey | HBKPLHDHFHMQCY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|