C11H20N2 — CID 177319953
N-methyl-4-(2-methyl-3,4-dihydropyridin-5-yl)butan-1-amine (PubChem CID 177319953) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is N-methyl-4-(2-methyl-3,4-dihydropyridin-5-yl)butan-1-amine.
| Compound Name | N-methyl-4-(2-methyl-3,4-dihydropyridin-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 177319953 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-methyl-4-(2-methyl-3,4-dihydropyridin-5-yl)butan-1-amine |
| SMILES | CNCCCCC1=CN=C(C)CC1 |
| InChI | InChI=1S/C11H20N2/c1-10-6-7-11(9-13-10)5-3-4-8-12-2/h9,12H,3-8H2,1-2H3 |
| InChIKey | XBLFQXDXDRYDTA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|