C19H18FNO3 — CID 177320378
N-[2-(4-fluorophenyl)ethyl]-2-(2-hydroxyethyl)-1-benzofuran-6-carboxamide (PubChem CID 177320378) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-(2-hydroxyethyl)-1-benzofuran-6-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-(2-hydroxyethyl)-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 177320378 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-(2-hydroxyethyl)-1-benzofuran-6-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc2cc(CCO)oc2c1 |
| InChI | InChI=1S/C19H18FNO3/c20-16-5-1-13(2-6-16)7-9-21-19(23)15-4-3-14-11-17(8-10-22)24-18(14)12-15/h1-6,11-12,22H,7-10H2,(H,21,23) |
| InChIKey | AMBMBSGNLRJAGR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |