C22H21F4N3O3 — CID 177322428
tert-butyl 3-(4-fluoro-3-phenylmethoxyanilino)-5-(trifluoromethyl)pyrazole-1-carboxylate (PubChem CID 177322428) has the molecular formula C22H21F4N3O3 and a molecular weight of 451.42 g/mol. Its IUPAC name is tert-butyl 3-(4-fluoro-3-phenylmethoxyanilino)-5-(trifluoromethyl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluoro-3-phenylmethoxyanilino)-5-(trifluoromethyl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 177322428 |
| Molecular Formula | C22H21F4N3O3 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | tert-butyl 3-(4-fluoro-3-phenylmethoxyanilino)-5-(trifluoromethyl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(Nc2ccc(F)c(OCc3ccccc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21F4N3O3/c1-21(2,3)32-20(30)29-18(22(24,25)26)12-19(28-29)27-15-9-10-16(23)17(11-15)31-13-14-7-5-4-6-8-14/h4-12H,13H2,1-3H3,(H,27,28) |
| InChIKey | ZDKAWUQPDRCNQD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |