C23H23N7O5S — CID 177323240
4-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-ylsulfonyl)-1,5-dimethyl-N-[(8-nitroquinolin-5-yl)methyl]pyrrole-2-carboxamide (PubChem CID 177323240) has the molecular formula C23H23N7O5S and a molecular weight of 509.55 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-ylsulfonyl)-1,5-dimethyl-N-[(8-nitroquinolin-5-yl)methyl]pyrrole-2-carboxamide.
| Compound Name | 4-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-ylsulfonyl)-1,5-dimethyl-N-[(8-nitroquinolin-5-yl)methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177323240 |
| Molecular Formula | C23H23N7O5S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 4-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-ylsulfonyl)-1,5-dimethyl-N-[(8-nitroquinolin-5-yl)methyl]pyrrole-2-carboxamide |
| SMILES | Cc1c(S(=O)(=O)N2CCn3nccc3C2)cc(C(=O)NCc2ccc([N+](=O)[O-])c3ncccc23)n1C |
| InChI | InChI=1S/C23H23N7O5S/c1-15-21(36(34,35)28-10-11-29-17(14-28)7-9-26-29)12-20(27(15)2)23(31)25-13-16-5-6-19(30(32)33)22-18(16)4-3-8-24-22/h3-9,12H,10-11,13-14H2,1-2H3,(H,25,31) |
| InChIKey | VSXFGUFLHRFXNA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|