C19H24BrF3N4O2 — CID 177325168
tert-butyl (2S,4S)-1-[7-bromo-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,4-dimethylpiperidine-4-carboxylate (PubChem CID 177325168) has the molecular formula C19H24BrF3N4O2 and a molecular weight of 477.33 g/mol. Its IUPAC name is tert-butyl (2S,4S)-1-[7-bromo-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,4-dimethylpiperidine-4-carboxylate.
| Compound Name | tert-butyl (2S,4S)-1-[7-bromo-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,4-dimethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 177325168 |
| Molecular Formula | C19H24BrF3N4O2 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | tert-butyl (2S,4S)-1-[7-bromo-5-(trifluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-2,4-dimethylpiperidine-4-carboxylate |
| SMILES | C[C@H]1C[C@@](C)(C(=O)OC(C)(C)C)CCN1c1ncnn2c(Br)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C19H24BrF3N4O2/c1-11-9-18(5,16(28)29-17(2,3)4)6-7-26(11)15-14-12(19(21,22)23)8-13(20)27(14)25-10-24-15/h8,10-11H,6-7,9H2,1-5H3/t11-,18-/m0/s1 |
| InChIKey | IBVWGKRBIUQMIR-VOJFVSQTSA-N |
| XLogP | 4.85 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |