C11H15NO2 — CID 177327214
propan-2-yl 3,5-dimethylpyridine-4-carboxylate (PubChem CID 177327214) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is propan-2-yl 3,5-dimethylpyridine-4-carboxylate.
| Compound Name | propan-2-yl 3,5-dimethylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 177327214 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | propan-2-yl 3,5-dimethylpyridine-4-carboxylate |
| SMILES | Cc1cncc(C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C11H15NO2/c1-7(2)14-11(13)10-8(3)5-12-6-9(10)4/h5-7H,1-4H3 |
| InChIKey | VRCJFNCXEXUHHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |