C18H15F3NO2+ — CID 177329696
[8-ethenyl-3-(trifluoromethyl)-6,7-dihydrobenzo[d][1]benzoxepin-9-yl]-hydroxy-methylideneazanium (PubChem CID 177329696) has the molecular formula C18H15F3NO2+ and a molecular weight of 334.32 g/mol. Its IUPAC name is [8-ethenyl-3-(trifluoromethyl)-6,7-dihydrobenzo[d][1]benzoxepin-9-yl]-hydroxy-methylideneazanium.
| Compound Name | [8-ethenyl-3-(trifluoromethyl)-6,7-dihydrobenzo[d][1]benzoxepin-9-yl]-hydroxy-methylideneazanium |
|---|---|
| PubChem CID | 177329696 |
| Molecular Formula | C18H15F3NO2+ |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [8-ethenyl-3-(trifluoromethyl)-6,7-dihydrobenzo[d][1]benzoxepin-9-yl]-hydroxy-methylideneazanium |
| SMILES | C=Cc1c([N+](=C)O)ccc2c1CCOc1cc(C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C18H15F3NO2/c1-3-12-14-8-9-24-17-10-11(18(19,20)21)4-5-15(17)13(14)6-7-16(12)22(2)23/h3-7,10,23H,1-2,8-9H2/q+1 |
| InChIKey | IBZLYNJQPPWIMF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|