C10H21N3 — CID 177331117
3-butan-2-yl-1,5-dimethyl-1,2,4-triazole;ethane (PubChem CID 177331117) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 3-butan-2-yl-1,5-dimethyl-1,2,4-triazole;ethane.
| Compound Name | 3-butan-2-yl-1,5-dimethyl-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 177331117 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 3-butan-2-yl-1,5-dimethyl-1,2,4-triazole;ethane |
| SMILES | CC.CCC(C)c1nc(C)n(C)n1 |
| InChI | InChI=1S/C8H15N3.C2H6/c1-5-6(2)8-9-7(3)11(4)10-8;1-2/h6H,5H2,1-4H3;1-2H3 |
| InChIKey | QEDVTIKQOHYVLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |