C7H13N3O2 — CID 162786607
3-(dimethoxymethyl)-1,5-dimethyl-1,2,4-triazole (PubChem CID 162786607) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-(dimethoxymethyl)-1,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-(dimethoxymethyl)-1,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 162786607 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-(dimethoxymethyl)-1,5-dimethyl-1,2,4-triazole |
| SMILES | COC(OC)c1nc(C)n(C)n1 |
| InChI | InChI=1S/C7H13N3O2/c1-5-8-6(9-10(5)2)7(11-3)12-4/h7H,1-4H3 |
| InChIKey | NREATKGYDDRXRR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|