C7H12N4 — CID 84649668
3-(azetidin-3-yl)-1,5-dimethyl-1,2,4-triazole (PubChem CID 84649668) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-(azetidin-3-yl)-1,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-(azetidin-3-yl)-1,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 84649668 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 3-(azetidin-3-yl)-1,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C2CNC2)nn1C |
| InChI | InChI=1S/C7H12N4/c1-5-9-7(10-11(5)2)6-3-8-4-6/h6,8H,3-4H2,1-2H3 |
| InChIKey | GOCVIPPIRCGRNT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |