C33H41ClN8O7 — CID 177331843
2-chloro-6-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-[(2R,3R)-3-[[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-nitrophenyl]methoxy]butan-2-yl]purine-9-carboxamide (PubChem CID 177331843) has the molecular formula C33H41ClN8O7 and a molecular weight of 697.19 g/mol. Its IUPAC name is 2-chloro-6-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-[(2R,3R)-3-[[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-nitrophenyl]methoxy]butan-2-yl]purine-9-carboxamide.
| Compound Name | 2-chloro-6-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-[(2R,3R)-3-[[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-nitrophenyl]methoxy]butan-2-yl]purine-9-carboxamide |
|---|---|
| PubChem CID | 177331843 |
| Molecular Formula | C33H41ClN8O7 |
| Molecular Weight | 697.19 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | 2-chloro-6-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-[(2R,3R)-3-[[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-nitrophenyl]methoxy]butan-2-yl]purine-9-carboxamide |
| SMILES | COc1ccc(CN(C)c2nc(Cl)nc3c2ncn3C(=O)N[C@H](C)[C@@H](C)OCc2cc(N3C[C@H](C)O[C@@H](C)C3)cc([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C33H41ClN8O7/c1-19-14-40(15-20(2)49-19)25-10-23(11-26(12-25)42(44)45)17-48-22(4)21(3)36-33(43)41-18-35-29-30(37-32(34)38-31(29)41)39(5)16-24-8-9-27(46-6)13-28(24)47-7/h8-13,18-22H,14-17H2,1-7H3,(H,36,43)/t19-,20-,21+,22+/m0/s1 |
| InChIKey | QXOWTSLASJHETF-FNAHDJPLSA-N |
| XLogP | 5.21 |
| TPSA | 159.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.19 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|