C25H37F5N4O2 — CID 177333484
6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-pentan-3-yloxypyridine-3-carbaldehyde;N,N'-dimethylethane-1,2-diamine;ethane (PubChem CID 177333484) has the molecular formula C25H37F5N4O2 and a molecular weight of 520.59 g/mol. Its IUPAC name is 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-pentan-3-yloxypyridine-3-carbaldehyde;N,N'-dimethylethane-1,2-diamine;ethane.
| Compound Name | 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-pentan-3-yloxypyridine-3-carbaldehyde;N,N'-dimethylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 177333484 |
| Molecular Formula | C25H37F5N4O2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 6-[5-amino-4-fluoro-3-methyl-2-(trifluoromethyl)phenyl]-5-fluoro-2-pentan-3-yloxypyridine-3-carbaldehyde;N,N'-dimethylethane-1,2-diamine;ethane |
| SMILES | CC.CCC(CC)Oc1nc(-c2cc(N)c(F)c(C)c2C(F)(F)F)c(F)cc1C=O.CNCCNC |
| InChI | InChI=1S/C19H19F5N2O2.C4H12N2.C2H6/c1-4-11(5-2)28-18-10(8-27)6-13(20)17(26-18)12-7-14(25)16(21)9(3)15(12)19(22,23)24;1-5-3-4-6-2;1-2/h6-8,11H,4-5,25H2,1-3H3;5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | XTVQPQUCSBTCKO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|